C24H26O7 — CID 166437376
3,3-bis(methoxycarbonyl)-6-oxo-5,8-diphenyloctanoic acid (PubChem CID 166437376) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3,3-bis(methoxycarbonyl)-6-oxo-5,8-diphenyloctanoic acid.
| Compound Name | 3,3-bis(methoxycarbonyl)-6-oxo-5,8-diphenyloctanoic acid |
|---|---|
| PubChem CID | 166437376 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3,3-bis(methoxycarbonyl)-6-oxo-5,8-diphenyloctanoic acid |
| SMILES | COC(=O)C(CC(=O)O)(CC(C(=O)CCc1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H26O7/c1-30-22(28)24(16-21(26)27,23(29)31-2)15-19(18-11-7-4-8-12-18)20(25)14-13-17-9-5-3-6-10-17/h3-12,19H,13-16H2,1-2H3,(H,26,27) |
| InChIKey | NIJWAFYLOXXLFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|