C21H19BrN6O2 — CID 43041655
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 43041655) has the molecular formula C21H19BrN6O2 and a molecular weight of 467.33 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 43041655 |
| Molecular Formula | C21H19BrN6O2 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-ethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | CCn1ncc2c(C(=O)NNC(=O)c3cc(Br)cn3C)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C21H19BrN6O2/c1-3-28-19-16(11-23-28)15(10-17(24-19)13-7-5-4-6-8-13)20(29)25-26-21(30)18-9-14(22)12-27(18)2/h4-12H,3H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | SHAKJTABXOYAMI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|