C20H18N6O2 — CID 78835097
1-ethyl-6-phenyl-N'-(1H-pyrrole-2-carbonyl)pyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 78835097) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-ethyl-6-phenyl-N'-(1H-pyrrole-2-carbonyl)pyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | 1-ethyl-6-phenyl-N'-(1H-pyrrole-2-carbonyl)pyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 78835097 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-ethyl-6-phenyl-N'-(1H-pyrrole-2-carbonyl)pyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | CCn1ncc2c(C(=O)NNC(=O)c3ccc[nH]3)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C20H18N6O2/c1-2-26-18-15(12-22-26)14(11-17(23-18)13-7-4-3-5-8-13)19(27)24-25-20(28)16-9-6-10-21-16/h3-12,21H,2H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | FCDGNWVOHYOMJK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|