C25H23N5O3 — CID 4304258
2-[2-(benzylamino)-6-methylpyrimidin-4-yl]oxy-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 4304258) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-[2-(benzylamino)-6-methylpyrimidin-4-yl]oxy-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-(benzylamino)-6-methylpyrimidin-4-yl]oxy-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4304258 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[2-(benzylamino)-6-methylpyrimidin-4-yl]oxy-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)NN=Cc2c(O)ccc3ccccc23)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C25H23N5O3/c1-17-13-24(29-25(28-17)26-14-18-7-3-2-4-8-18)33-16-23(32)30-27-15-21-20-10-6-5-9-19(20)11-12-22(21)31/h2-13,15,31H,14,16H2,1H3,(H,30,32)(H,26,28,29) |
| InChIKey | BLPCQANUEBJHBR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|