C23H29N3O4 — CID 43043397
1-(furan-2-carbonyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 43043397) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43043397 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C23H29N3O4/c1-24(16-18-6-8-20(9-7-18)25-11-14-29-15-12-25)22(27)19-4-2-10-26(17-19)23(28)21-5-3-13-30-21/h3,5-9,13,19H,2,4,10-12,14-17H2,1H3 |
| InChIKey | SISMWXWPJHDFGN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|