C19H20ClN3O5 — CID 42938378
N-[(2-chloro-5-nitrophenyl)methyl]-1-(furan-2-carbonyl)-N-methylpiperidine-3-carboxamide (PubChem CID 42938378) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-1-(furan-2-carbonyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-1-(furan-2-carbonyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42938378 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-1-(furan-2-carbonyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C19H20ClN3O5/c1-21(11-14-10-15(23(26)27)6-7-16(14)20)18(24)13-4-2-8-22(12-13)19(25)17-5-3-9-28-17/h3,5-7,9-10,13H,2,4,8,11-12H2,1H3 |
| InChIKey | KIOWGXXDQGYUSC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|