C23H29NO3 — CID 43044181
N-[3-(2,4-dimethylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 43044181) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[3-(2,4-dimethylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[3-(2,4-dimethylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43044181 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[3-(2,4-dimethylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | Cc1ccc(CCCNC(=O)c2cccc(OCC3CCCO3)c2)c(C)c1 |
| InChI | InChI=1S/C23H29NO3/c1-17-10-11-19(18(2)14-17)7-4-12-24-23(25)20-6-3-8-21(15-20)27-16-22-9-5-13-26-22/h3,6,8,10-11,14-15,22H,4-5,7,9,12-13,16H2,1-2H3,(H,24,25) |
| InChIKey | WEGVPQPOBFCQSG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|