C22H27NO3 — CID 46420066
N-[1-(4-methylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 46420066) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[1-(4-methylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46420066 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[1-(4-methylphenyl)propyl]-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CCC(NC(=O)c1cccc(OCC2CCCO2)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-3-21(17-11-9-16(2)10-12-17)23-22(24)18-6-4-7-19(14-18)26-15-20-8-5-13-25-20/h4,6-7,9-12,14,20-21H,3,5,8,13,15H2,1-2H3,(H,23,24) |
| InChIKey | ZSBPPMFIOQCFFZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |