C18H23N3O3 — CID 38615399
3-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-1-pyrazol-1-ylpropan-2-yl]benzamide (PubChem CID 38615399) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-1-pyrazol-1-ylpropan-2-yl]benzamide.
| Compound Name | 3-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-1-pyrazol-1-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 38615399 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-1-pyrazol-1-ylpropan-2-yl]benzamide |
| SMILES | C[C@@H](Cn1cccn1)NC(=O)c1cccc(OC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-14(12-21-9-4-8-19-21)20-18(22)15-5-2-6-16(11-15)24-13-17-7-3-10-23-17/h2,4-6,8-9,11,14,17H,3,7,10,12-13H2,1H3,(H,20,22)/t14-,17-/m0/s1 |
| InChIKey | TXHGPPAYUGPGPN-YOEHRIQHSA-N |
| XLogP | 2.26 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |