C20H20N2O6 — CID 43046534
methyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-5-nitrobenzoate (PubChem CID 43046534) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-5-nitrobenzoate.
| Compound Name | methyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 43046534 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | methyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H20N2O6/c1-26-20(23)15-12-14(22(24)25)5-6-17(15)21-8-2-3-16(21)13-4-7-18-19(11-13)28-10-9-27-18/h4-7,11-12,16H,2-3,8-10H2,1H3 |
| InChIKey | JDUZSUNLMRHMPW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|