C18H24F3NO3 — CID 43046784
3-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 43046784) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 43046784 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NC2CCCCC2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H24F3NO3/c1-24-15-9-7-12(11-16(15)25-2)8-10-17(23)22-14-6-4-3-5-13(14)18(19,20)21/h7,9,11,13-14H,3-6,8,10H2,1-2H3,(H,22,23) |
| InChIKey | HHCZJOWVCSCUBG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |