C14H23F3N2O3S — CID 43046836
1-methylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide (PubChem CID 43046836) has the molecular formula C14H23F3N2O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43046836 |
| Molecular Formula | C14H23F3N2O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-methylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NC2CCCCC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2O3S/c1-23(21,22)19-8-6-10(7-9-19)13(20)18-12-5-3-2-4-11(12)14(15,16)17/h10-12H,2-9H2,1H3,(H,18,20) |
| InChIKey | KJYUUBMOPNNIFC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |