C17H29F3N2OS — CID 163294713
1-tert-butylsulfanyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide (PubChem CID 163294713) has the molecular formula C17H29F3N2OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide.
| Compound Name | 1-tert-butylsulfanyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163294713 |
| Molecular Formula | C17H29F3N2OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 1-tert-butylsulfanyl-N-[4-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)SN1CCC(C(=O)NC2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H29F3N2OS/c1-16(2,3)24-22-10-8-12(9-11-22)15(23)21-14-6-4-13(5-7-14)17(18,19)20/h12-14H,4-11H2,1-3H3,(H,21,23) |
| InChIKey | VSKNIYQWPRWKJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|