C19H19ClN4O5S — CID 43047298
2-[(6-chloro-3-pyridinyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino]-N-(4-ethoxyphenyl)acetamide (PubChem CID 43047298) has the molecular formula C19H19ClN4O5S and a molecular weight of 450.90 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43047298 |
| Molecular Formula | C19H19ClN4O5S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN(c2cc(C)on2)S(=O)(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C19H19ClN4O5S/c1-3-28-15-6-4-14(5-7-15)22-19(25)12-24(18-10-13(2)29-23-18)30(26,27)16-8-9-17(20)21-11-16/h4-11H,3,12H2,1-2H3,(H,22,25) |
| InChIKey | WZGWDSTVWCATIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|