C17H15Cl2N3O4S — CID 30659159
6-chloro-N-[2-(2-chlorophenoxy)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide (PubChem CID 30659159) has the molecular formula C17H15Cl2N3O4S and a molecular weight of 428.30 g/mol. Its IUPAC name is 6-chloro-N-[2-(2-chlorophenoxy)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2-(2-chlorophenoxy)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 30659159 |
| Molecular Formula | C17H15Cl2N3O4S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 6-chloro-N-[2-(2-chlorophenoxy)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(N(CCOc2ccccc2Cl)S(=O)(=O)c2ccc(Cl)nc2)no1 |
| InChI | InChI=1S/C17H15Cl2N3O4S/c1-12-10-17(21-26-12)22(8-9-25-15-5-3-2-4-14(15)18)27(23,24)13-6-7-16(19)20-11-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | MSHCSXRRPMRRHW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|