C24H29NO3 — CID 43048242
4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-[3-(1-phenylethoxy)propyl]butanamide (PubChem CID 43048242) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-[3-(1-phenylethoxy)propyl]butanamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-[3-(1-phenylethoxy)propyl]butanamide |
|---|---|
| PubChem CID | 43048242 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-[3-(1-phenylethoxy)propyl]butanamide |
| SMILES | CC(OCCCNC(=O)CCC(=O)c1ccc2c(c1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C24H29NO3/c1-18(19-7-3-2-4-8-19)28-16-6-15-25-24(27)14-13-23(26)22-12-11-20-9-5-10-21(20)17-22/h2-4,7-8,11-12,17-18H,5-6,9-10,13-16H2,1H3,(H,25,27) |
| InChIKey | CZNLWKJLDSLUCI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|