C12H6N6O2 — CID 43048313
1-(8-nitroisoquinolin-5-yl)-1,2,4-triazole-3-carbonitrile (PubChem CID 43048313) has the molecular formula C12H6N6O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 1-(8-nitroisoquinolin-5-yl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(8-nitroisoquinolin-5-yl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 43048313 |
| Molecular Formula | C12H6N6O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-(8-nitroisoquinolin-5-yl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(-c2ccc([N+](=O)[O-])c3cnccc23)n1 |
| InChI | InChI=1S/C12H6N6O2/c13-5-12-15-7-17(16-12)10-1-2-11(18(19)20)9-6-14-4-3-8(9)10/h1-4,6-7H |
| InChIKey | LDSZTNQETKRARL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|