C12H8N6 — CID 103139530
1-(5-aminoisoquinolin-8-yl)-1,2,4-triazole-3-carbonitrile (PubChem CID 103139530) has the molecular formula C12H8N6 and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-(5-aminoisoquinolin-8-yl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(5-aminoisoquinolin-8-yl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 103139530 |
| Molecular Formula | C12H8N6 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(5-aminoisoquinolin-8-yl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(-c2ccc(N)c3ccncc23)n1 |
| InChI | InChI=1S/C12H8N6/c13-5-12-16-7-18(17-12)11-2-1-10(14)8-3-4-15-6-9(8)11/h1-4,6-7H,14H2 |
| InChIKey | AIAYKMXFXKNALW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|