C23H18N4O3 — CID 43048343
N-[3-(2-amino-2-oxoethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 43048343) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 43048343 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | NC(=O)COc1cccc(NC(=O)c2cc(-c3ccncc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C23H18N4O3/c24-22(28)14-30-17-5-3-4-16(12-17)26-23(29)19-13-21(15-8-10-25-11-9-15)27-20-7-2-1-6-18(19)20/h1-13H,14H2,(H2,24,28)(H,26,29) |
| InChIKey | VQPHBHMNCRKEFU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |