C22H15F2N3O2 — CID 55778991
N-[3-(difluoromethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 55778991) has the molecular formula C22H15F2N3O2 and a molecular weight of 391.38 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55778991 |
| Molecular Formula | C22H15F2N3O2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C22H15F2N3O2/c23-22(24)29-16-5-3-4-15(12-16)26-21(28)18-13-20(14-8-10-25-11-9-14)27-19-7-2-1-6-17(18)19/h1-13,22H,(H,26,28) |
| InChIKey | UYOIYBKSBSTDGN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |