C20H20FN5O3S — CID 43048714
5-[(N-(3-amino-3-oxopropyl)-4-methoxyanilino)methyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 43048714) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is 5-[(N-(3-amino-3-oxopropyl)-4-methoxyanilino)methyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(N-(3-amino-3-oxopropyl)-4-methoxyanilino)methyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 43048714 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[(N-(3-amino-3-oxopropyl)-4-methoxyanilino)methyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | COc1ccc(N(CCC(N)=O)Cc2nnc(C(=O)Nc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C20H20FN5O3S/c1-29-16-8-6-15(7-9-16)26(11-10-17(22)27)12-18-24-25-20(30-18)19(28)23-14-4-2-13(21)3-5-14/h2-9H,10-12H2,1H3,(H2,22,27)(H,23,28) |
| InChIKey | ISWAIEATEXXLBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|