C20H24N4O4 — CID 24561184
3-(N-[2-(4-acetamidoanilino)-2-oxoethyl]-4-methoxyanilino)propanamide (PubChem CID 24561184) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-(N-[2-(4-acetamidoanilino)-2-oxoethyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-(4-acetamidoanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 24561184 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-(N-[2-(4-acetamidoanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)Nc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-14(25)22-15-3-5-16(6-4-15)23-20(27)13-24(12-11-19(21)26)17-7-9-18(28-2)10-8-17/h3-10H,11-13H2,1-2H3,(H2,21,26)(H,22,25)(H,23,27) |
| InChIKey | UBGJVEUOZZCALX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|