C20H25N3O5 — CID 18124684
3-(N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide (PubChem CID 18124684) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-(N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 18124684 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-(N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)Nc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C20H25N3O5/c1-26-16-6-4-15(5-7-16)23(9-8-19(21)24)13-20(25)22-14-10-17(27-2)12-18(11-14)28-3/h4-7,10-12H,8-9,13H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | XZTXJQKOHSODCW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|