C20H24ClN3O5 — CID 18127351
3-(N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide (PubChem CID 18127351) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is 3-(N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 18127351 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-(N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)CC(=O)Nc2cc(Cl)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H24ClN3O5/c1-27-14-6-4-13(5-7-14)24(9-8-19(22)25)12-20(26)23-16-10-15(21)17(28-2)11-18(16)29-3/h4-7,10-11H,8-9,12H2,1-3H3,(H2,22,25)(H,23,26) |
| InChIKey | MMGSYNJWFJVANW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|