C20H13F3N4O4S — CID 43050983
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-5-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 43050983) has the molecular formula C20H13F3N4O4S and a molecular weight of 462.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-5-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-5-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43050983 |
| Molecular Formula | C20H13F3N4O4S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-5-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2noc(CSc3nnc(C4COc5ccccc5O4)o3)n2)cc1 |
| InChI | InChI=1S/C20H13F3N4O4S/c21-20(22,23)12-7-5-11(6-8-12)17-24-16(31-27-17)10-32-19-26-25-18(30-19)15-9-28-13-3-1-2-4-14(13)29-15/h1-8,15H,9-10H2 |
| InChIKey | WXKNRJVIWFZYLR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |