C18H15N5O3S2 — CID 46618209
5-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-thiophen-3-yl-1,2,4-oxadiazole (PubChem CID 46618209) has the molecular formula C18H15N5O3S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 5-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-thiophen-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-thiophen-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46618209 |
| Molecular Formula | C18H15N5O3S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 5-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-thiophen-3-yl-1,2,4-oxadiazole |
| SMILES | Cn1c(SCc2nc(-c3ccsc3)no2)nnc1C1COc2ccccc2O1 |
| InChI | InChI=1S/C18H15N5O3S2/c1-23-17(14-8-24-12-4-2-3-5-13(12)25-14)20-21-18(23)28-10-15-19-16(22-26-15)11-6-7-27-9-11/h2-7,9,14H,8,10H2,1H3 |
| InChIKey | MFMYZCCRSJUIEA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |