C23H22N4O4S2 — CID 31279243
4-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3,4-dimethoxyphenyl)-1,3-thiazole (PubChem CID 31279243) has the molecular formula C23H22N4O4S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 4-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3,4-dimethoxyphenyl)-1,3-thiazole.
| Compound Name | 4-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3,4-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 31279243 |
| Molecular Formula | C23H22N4O4S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3,4-dimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(CSc3nnc([C@@H]4COc5ccccc5O4)n3C)cs2)cc1OC |
| InChI | InChI=1S/C23H22N4O4S2/c1-27-21(20-11-30-17-6-4-5-7-18(17)31-20)25-26-23(27)33-13-15-12-32-22(24-15)14-8-9-16(28-2)19(10-14)29-3/h4-10,12,20H,11,13H2,1-3H3/t20-/m0/s1 |
| InChIKey | XWOJVIMMGFHSKD-FQEVSTJZSA-N |
| XLogP | 4.76 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |