C22H18F3N3O2 — CID 43052359
6-methyl-4-oxo-N-phenyl-N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 43052359) has the molecular formula C22H18F3N3O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-phenyl-N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-phenyl-N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 43052359 |
| Molecular Formula | C22H18F3N3O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 6-methyl-4-oxo-N-phenyl-N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | C=CCN(C(=O)c1nn(-c2cccc(C(F)(F)F)c2)c(C)cc1=O)c1ccccc1 |
| InChI | InChI=1S/C22H18F3N3O2/c1-3-12-27(17-9-5-4-6-10-17)21(30)20-19(29)13-15(2)28(26-20)18-11-7-8-16(14-18)22(23,24)25/h3-11,13-14H,1,12H2,2H3 |
| InChIKey | GRTPGVGXCKGWSB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|