About 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile
4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile (PubChem CID 43052609) has the molecular formula C16H12ClF3N2O
and a molecular weight of 340.73 g/mol. Its IUPAC name is 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile |
| PubChem CID | 43052609 |
| Molecular Formula | C16H12ClF3N2O |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2cc(Cl)ccc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O/c17-13-5-6-15(23-10-16(18,19)20)14(7-13)22-9-12-3-1-11(8-21)2-4-12/h1-7,22H,9-10H2 |
| InChIKey | JPAOHOZSPZSMCP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile?
The IUPAC name of 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile (CID 43052609) is 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile.
What is the SMILES notation for 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile?
The canonical SMILES for 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile is N#Cc1ccc(CNc2cc(Cl)ccc2OCC(F)(F)F)cc1.
What is the InChIKey of 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile?
The InChIKey is JPAOHOZSPZSMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClF3N2O/c17-13-5-6-15(23-10-16(18,19)20)14(7-13)22-9-12-3-1-11(8-21)2-4-12/h1-7,22H,9-10H2.
What are the key properties of 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile?
4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile has a molecular weight of 340.73 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile is sourced from PubChem (CID 43052609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).