C16H12ClF3N2O — CID 43052609
4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile (PubChem CID 43052609) has the molecular formula C16H12ClF3N2O and a molecular weight of 340.73 g/mol. Its IUPAC name is 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile.
| Compound Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile |
|---|---|
| PubChem CID | 43052609 |
| Molecular Formula | C16H12ClF3N2O |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)anilino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2cc(Cl)ccc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O/c17-13-5-6-15(23-10-16(18,19)20)14(7-13)22-9-12-3-1-11(8-21)2-4-12/h1-7,22H,9-10H2 |
| InChIKey | JPAOHOZSPZSMCP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |