C27H25N3O3 — CID 43052968
2-[[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]amino]-N-benzylbenzamide (PubChem CID 43052968) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]amino]-N-benzylbenzamide.
| Compound Name | 2-[[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]amino]-N-benzylbenzamide |
|---|---|
| PubChem CID | 43052968 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]amino]-N-benzylbenzamide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O3/c1-19(31)30-16-15-21-11-5-6-12-22(21)25(30)17-26(32)29-24-14-8-7-13-23(24)27(33)28-18-20-9-3-2-4-10-20/h2-16,25H,17-18H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | RPVOYNKYWMGWIZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |