C21H20FN3O3 — CID 9091953
2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]-N'-[2-(4-fluorophenyl)acetyl]acetohydrazide (PubChem CID 9091953) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]-N'-[2-(4-fluorophenyl)acetyl]acetohydrazide.
| Compound Name | 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]-N'-[2-(4-fluorophenyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9091953 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[(1R)-2-acetyl-1H-isoquinolin-1-yl]-N'-[2-(4-fluorophenyl)acetyl]acetohydrazide |
| SMILES | CC(=O)N1C=Cc2ccccc2[C@H]1CC(=O)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-14(26)25-11-10-16-4-2-3-5-18(16)19(25)13-21(28)24-23-20(27)12-15-6-8-17(22)9-7-15/h2-11,19H,12-13H2,1H3,(H,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | UYDJEWYSLOUOMD-LJQANCHMSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|