C24H27N3O4 — CID 51938149
2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]-N-[4-[2-(2-methoxyethylamino)-2-oxoethyl]phenyl]acetamide (PubChem CID 51938149) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]-N-[4-[2-(2-methoxyethylamino)-2-oxoethyl]phenyl]acetamide.
| Compound Name | 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]-N-[4-[2-(2-methoxyethylamino)-2-oxoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 51938149 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]-N-[4-[2-(2-methoxyethylamino)-2-oxoethyl]phenyl]acetamide |
| SMILES | COCCNC(=O)Cc1ccc(NC(=O)C[C@H]2c3ccccc3C=CN2C(C)=O)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-17(28)27-13-11-19-5-3-4-6-21(19)22(27)16-24(30)26-20-9-7-18(8-10-20)15-23(29)25-12-14-31-2/h3-11,13,22H,12,14-16H2,1-2H3,(H,25,29)(H,26,30)/t22-/m0/s1 |
| InChIKey | PLNIQEOYNSOJIE-QFIPXVFZSA-N |
| XLogP | 2.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|