C22H20FN5O3S2 — CID 43056288
N-(4-fluorophenyl)-5-[[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 43056288) has the molecular formula C22H20FN5O3S2 and a molecular weight of 485.57 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-[[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 43056288 |
| Molecular Formula | C22H20FN5O3S2 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-(4-fluorophenyl)-5-[[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | COCCCn1c(SCc2nnc(C(=O)Nc3ccc(F)cc3)s2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H20FN5O3S2/c1-31-12-4-11-28-21(30)16-5-2-3-6-17(16)25-22(28)32-13-18-26-27-20(33-18)19(29)24-15-9-7-14(23)8-10-15/h2-3,5-10H,4,11-13H2,1H3,(H,24,29) |
| InChIKey | BAHBVWSFWLKQKD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|