C21H19NO5S — CID 43056522
2-benzoyloxyethyl 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 43056522) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-benzoyloxyethyl 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-benzoyloxyethyl 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 43056522 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-benzoyloxyethyl 2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | Cc1ccc(OCc2nc(C(=O)OCCOC(=O)c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C21H19NO5S/c1-15-7-9-17(10-8-15)27-13-19-22-18(14-28-19)21(24)26-12-11-25-20(23)16-5-3-2-4-6-16/h2-10,14H,11-13H2,1H3 |
| InChIKey | NNFRMNDYUHILDI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|