C21H22N4OS — CID 43056682
N-[4-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 43056682) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[4-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43056682 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[4-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC(Nc1ncnc2sc3c(c12)CCC3)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H22N4OS/c1-12(13-7-9-15(10-8-13)25-20(26)14-5-6-14)24-19-18-16-3-2-4-17(16)27-21(18)23-11-22-19/h7-12,14H,2-6H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | IJVNTZSFFFJBBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |