C19H28N2O5 — CID 43057044
ethyl 3-[1-(2,5-dimethoxyphenyl)ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 43057044) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 3-[1-(2,5-dimethoxyphenyl)ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[1-(2,5-dimethoxyphenyl)ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43057044 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | ethyl 3-[1-(2,5-dimethoxyphenyl)ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)NC(C)c2cc(OC)ccc2OC)C1 |
| InChI | InChI=1S/C19H28N2O5/c1-5-26-19(23)21-10-6-7-14(12-21)18(22)20-13(2)16-11-15(24-3)8-9-17(16)25-4/h8-9,11,13-14H,5-7,10,12H2,1-4H3,(H,20,22) |
| InChIKey | MAYKSGGYBZAFAO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |