C19H27N3O5 — CID 43057335
ethyl 3-[[1-(furan-3-carbonyl)piperidin-4-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 43057335) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl 3-[[1-(furan-3-carbonyl)piperidin-4-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[[1-(furan-3-carbonyl)piperidin-4-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43057335 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 3-[[1-(furan-3-carbonyl)piperidin-4-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)NC2CCN(C(=O)c3ccoc3)CC2)C1 |
| InChI | InChI=1S/C19H27N3O5/c1-2-27-19(25)22-8-3-4-14(12-22)17(23)20-16-5-9-21(10-6-16)18(24)15-7-11-26-13-15/h7,11,13-14,16H,2-6,8-10,12H2,1H3,(H,20,23) |
| InChIKey | OYZTUZWZXRBHPV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |