C21H29N3O4 — CID 51725856
ethyl (3R)-3-[(1-benzoylpiperidin-4-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 51725856) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl (3R)-3-[(1-benzoylpiperidin-4-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl (3R)-3-[(1-benzoylpiperidin-4-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 51725856 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethyl (3R)-3-[(1-benzoylpiperidin-4-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC[C@@H](C(=O)NC2CCN(C(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-28-21(27)24-12-6-9-17(15-24)19(25)22-18-10-13-23(14-11-18)20(26)16-7-4-3-5-8-16/h3-5,7-8,17-18H,2,6,9-15H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | ZQMDADJVLUTRLV-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |