C18H21F3N4O2S — CID 43057430
3-(2-amino-2-oxoethyl)sulfanyl-N-[1-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]ethyl]propanamide (PubChem CID 43057430) has the molecular formula C18H21F3N4O2S and a molecular weight of 414.45 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]ethyl]propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 43057430 |
| Molecular Formula | C18H21F3N4O2S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]ethyl]propanamide |
| SMILES | Cc1c(C(C)NC(=O)CCSCC(N)=O)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F3N4O2S/c1-11(24-17(27)6-7-28-10-16(22)26)15-9-23-25(12(15)2)14-5-3-4-13(8-14)18(19,20)21/h3-5,8-9,11H,6-7,10H2,1-2H3,(H2,22,26)(H,24,27) |
| InChIKey | HAHDDRMDZGPXMT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|