C17H25N3O3S — CID 43057620
3-(2-amino-2-oxoethyl)sulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)propanamide (PubChem CID 43057620) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 43057620 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2-morpholin-4-yl-2-phenylethyl)propanamide |
| SMILES | NC(=O)CSCCC(=O)NCC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O3S/c18-16(21)13-24-11-6-17(22)19-12-15(14-4-2-1-3-5-14)20-7-9-23-10-8-20/h1-5,15H,6-13H2,(H2,18,21)(H,19,22) |
| InChIKey | WLEWREKWBOLISP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|