C21H30N4O4S — CID 43058046
1-(3-ethylphenyl)-4-(4-pyrrolidin-1-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 43058046) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-4-(4-pyrrolidin-1-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(3-ethylphenyl)-4-(4-pyrrolidin-1-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 43058046 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-(3-ethylphenyl)-4-(4-pyrrolidin-1-ylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | CCc1cccc(N2CC(C(=O)N3CCN(S(=O)(=O)N4CCCC4)CC3)CC2=O)c1 |
| InChI | InChI=1S/C21H30N4O4S/c1-2-17-6-5-7-19(14-17)25-16-18(15-20(25)26)21(27)22-10-12-24(13-11-22)30(28,29)23-8-3-4-9-23/h5-7,14,18H,2-4,8-13,15-16H2,1H3 |
| InChIKey | OAASIDPNSACQCD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |