C17H15Cl2N3O2 — CID 43059071
N',1-bis(3-chlorophenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 43059071) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is N',1-bis(3-chlorophenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N',1-bis(3-chlorophenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43059071 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N',1-bis(3-chlorophenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNc1cccc(Cl)c1)C1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H15Cl2N3O2/c18-12-3-1-5-14(8-12)20-21-17(24)11-7-16(23)22(10-11)15-6-2-4-13(19)9-15/h1-6,8-9,11,20H,7,10H2,(H,21,24) |
| InChIKey | MVTZVXRXQRWDRO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|