C20H22ClN3O5 — CID 43057495
N'-(3-chlorophenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide (PubChem CID 43057495) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide.
| Compound Name | N'-(3-chlorophenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43057495 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N'-(3-chlorophenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide |
| SMILES | COc1cc(N2CC(C(=O)NNc3cccc(Cl)c3)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H22ClN3O5/c1-27-16-9-15(10-17(28-2)19(16)29-3)24-11-12(7-18(24)25)20(26)23-22-14-6-4-5-13(21)8-14/h4-6,8-10,12,22H,7,11H2,1-3H3,(H,23,26) |
| InChIKey | MQTREQJJVOZFPG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|