C19H24FN3O4S — CID 43060840
2-[2-[4-(4-fluorophenoxy)butylamino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 43060840) has the molecular formula C19H24FN3O4S and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenoxy)butylamino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 2-[2-[4-(4-fluorophenoxy)butylamino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 43060840 |
| Molecular Formula | C19H24FN3O4S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[2-[4-(4-fluorophenoxy)butylamino]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)SCC(=O)NCCCCOc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C19H24FN3O4S/c1-13-11-17(23-27-13)22-19(25)14(2)28-12-18(24)21-9-3-4-10-26-16-7-5-15(20)6-8-16/h5-8,11,14H,3-4,9-10,12H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | PQVWAZGEMXWXNL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|