C22H22BrN3O3S — CID 43060960
(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone (PubChem CID 43060960) has the molecular formula C22H22BrN3O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone.
| Compound Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone |
|---|---|
| PubChem CID | 43060960 |
| Molecular Formula | C22H22BrN3O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | (8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl)methanone |
| SMILES | CC1Cc2cc(C(=O)N3CCc4[nH]c5ccc(Br)cc5c4C3)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C22H22BrN3O3S/c1-13-9-15-10-14(3-6-21(15)26(13)30(2,28)29)22(27)25-8-7-20-18(12-25)17-11-16(23)4-5-19(17)24-20/h3-6,10-11,13,24H,7-9,12H2,1-2H3 |
| InChIKey | VCPFOXYRKSHADL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|