C20H21F4N3O2 — CID 43062013
2-(4-fluorophenyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide (PubChem CID 43062013) has the molecular formula C20H21F4N3O2 and a molecular weight of 411.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43062013 |
| Molecular Formula | C20H21F4N3O2 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide |
| SMILES | NC(=O)C(c1ccc(F)cc1)N1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H21F4N3O2/c21-16-5-3-15(4-6-16)18(19(25)28)27-11-9-26(10-12-27)13-14-1-7-17(8-2-14)29-20(22,23)24/h1-8,18H,9-13H2,(H2,25,28) |
| InChIKey | JJOWGDULARGPNW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |