C19H18FNO2S — CID 43062587
N-[[2-(ethoxymethyl)phenyl]methyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 43062587) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[[2-(ethoxymethyl)phenyl]methyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(ethoxymethyl)phenyl]methyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43062587 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[[2-(ethoxymethyl)phenyl]methyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CCOCc1ccccc1CNC(=O)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C19H18FNO2S/c1-2-23-12-14-7-4-3-6-13(14)11-21-19(22)18-10-15-16(20)8-5-9-17(15)24-18/h3-10H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | NOLJLKWLVJYFOI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |