C19H29N3O4S — CID 43064823
3-morpholin-4-ylsulfonyl-N-(2-pyrrolidin-1-ylbutyl)benzamide (PubChem CID 43064823) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-N-(2-pyrrolidin-1-ylbutyl)benzamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-N-(2-pyrrolidin-1-ylbutyl)benzamide |
|---|---|
| PubChem CID | 43064823 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-N-(2-pyrrolidin-1-ylbutyl)benzamide |
| SMILES | CCC(CNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)N1CCCC1 |
| InChI | InChI=1S/C19H29N3O4S/c1-2-17(21-8-3-4-9-21)15-20-19(23)16-6-5-7-18(14-16)27(24,25)22-10-12-26-13-11-22/h5-7,14,17H,2-4,8-13,15H2,1H3,(H,20,23) |
| InChIKey | OTFGOZKEHTYOGW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |