C22H33N3O5S — CID 55602817
N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55602817) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55602817 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCC(C1CCOC1)N1CCOCC1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H33N3O5S/c26-22(23-16-21(19-7-12-30-17-19)24-10-13-29-14-11-24)18-5-4-6-20(15-18)31(27,28)25-8-2-1-3-9-25/h4-6,15,19,21H,1-3,7-14,16-17H2,(H,23,26) |
| InChIKey | HLIPSNSSCKGSGK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |