C19H28ClN3O5S — CID 55642370
4-chloro-3-(dimethylsulfamoyl)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide (PubChem CID 55642370) has the molecular formula C19H28ClN3O5S and a molecular weight of 445.97 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55642370 |
| Molecular Formula | C19H28ClN3O5S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCC(C2CCOC2)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C19H28ClN3O5S/c1-22(2)29(25,26)18-11-14(3-4-16(18)20)19(24)21-12-17(15-5-8-28-13-15)23-6-9-27-10-7-23/h3-4,11,15,17H,5-10,12-13H2,1-2H3,(H,21,24) |
| InChIKey | YPGRFMNDJIEKCF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |